C26H30ClNO4 — CID 174496687
3-[[6-[4-(2-chlorophenyl)butoxy]naphthalen-2-yl]methyl-(2-hydroxyethyl)amino]propanoic acid (PubChem CID 174496687) has the molecular formula C26H30ClNO4 and a molecular weight of 455.98 g/mol. Its IUPAC name is 3-[[6-[4-(2-chlorophenyl)butoxy]naphthalen-2-yl]methyl-(2-hydroxyethyl)amino]propanoic acid.
| Compound Name | 3-[[6-[4-(2-chlorophenyl)butoxy]naphthalen-2-yl]methyl-(2-hydroxyethyl)amino]propanoic acid |
|---|---|
| PubChem CID | 174496687 |
| Molecular Formula | C26H30ClNO4 |
| Molecular Weight | 455.98 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | 3-[[6-[4-(2-chlorophenyl)butoxy]naphthalen-2-yl]methyl-(2-hydroxyethyl)amino]propanoic acid |
| SMILES | O=C(O)CCN(CCO)Cc1ccc2cc(OCCCCc3ccccc3Cl)ccc2c1 |
| InChI | InChI=1S/C26H30ClNO4/c27-25-7-2-1-5-21(25)6-3-4-16-32-24-11-10-22-17-20(8-9-23(22)18-24)19-28(14-15-29)13-12-26(30)31/h1-2,5,7-11,17-18,29H,3-4,6,12-16,19H2,(H,30,31) |
| InChIKey | RCMBBKGWIMHRAM-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.98 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|