C34H41NO5 — CID 66689165
2-[[6-(5-phenylpentoxy)naphthalen-2-yl]methyl-[(2,4,6-trimethoxyphenyl)methyl]amino]ethanol (PubChem CID 66689165) has the molecular formula C34H41NO5 and a molecular weight of 543.70 g/mol. Its IUPAC name is 2-[[6-(5-phenylpentoxy)naphthalen-2-yl]methyl-[(2,4,6-trimethoxyphenyl)methyl]amino]ethanol.
| Compound Name | 2-[[6-(5-phenylpentoxy)naphthalen-2-yl]methyl-[(2,4,6-trimethoxyphenyl)methyl]amino]ethanol |
|---|---|
| PubChem CID | 66689165 |
| Molecular Formula | C34H41NO5 |
| Molecular Weight | 543.70 g/mol |
| Exact Mass | 543.30 |
| IUPAC Name | 2-[[6-(5-phenylpentoxy)naphthalen-2-yl]methyl-[(2,4,6-trimethoxyphenyl)methyl]amino]ethanol |
| SMILES | COc1cc(OC)c(CN(CCO)Cc2ccc3cc(OCCCCCc4ccccc4)ccc3c2)c(OC)c1 |
| InChI | InChI=1S/C34H41NO5/c1-37-31-22-33(38-2)32(34(23-31)39-3)25-35(17-18-36)24-27-13-14-29-21-30(16-15-28(29)20-27)40-19-9-5-8-12-26-10-6-4-7-11-26/h4,6-7,10-11,13-16,20-23,36H,5,8-9,12,17-19,24-25H2,1-3H3 |
| InChIKey | XCSGDXBNCMKSSO-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.70 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|