C27H41N2O6P — CID 168720699
2-[3-(3-decoxyphenyl)propanoyl-(pyridin-4-ylmethyl)amino]ethyl dihydrogen phosphate (PubChem CID 168720699) has the molecular formula C27H41N2O6P and a molecular weight of 520.61 g/mol. Its IUPAC name is 2-[3-(3-decoxyphenyl)propanoyl-(pyridin-4-ylmethyl)amino]ethyl dihydrogen phosphate.
| Compound Name | 2-[3-(3-decoxyphenyl)propanoyl-(pyridin-4-ylmethyl)amino]ethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 168720699 |
| Molecular Formula | C27H41N2O6P |
| Molecular Weight | 520.61 g/mol |
| Exact Mass | 520.27 |
| IUPAC Name | 2-[3-(3-decoxyphenyl)propanoyl-(pyridin-4-ylmethyl)amino]ethyl dihydrogen phosphate |
| SMILES | CCCCCCCCCCOc1cccc(CCC(=O)N(CCOP(=O)(O)O)Cc2ccncc2)c1 |
| InChI | InChI=1S/C27H41N2O6P/c1-2-3-4-5-6-7-8-9-20-34-26-12-10-11-24(22-26)13-14-27(30)29(19-21-35-36(31,32)33)23-25-15-17-28-18-16-25/h10-12,15-18,22H,2-9,13-14,19-21,23H2,1H3,(H2,31,32,33) |
| InChIKey | VHNQUMGTCAIAGR-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 109.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.61 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|