About 1-(diethylamino)-6-(3-methoxyphenyl)hexan-3-one;nitroxyl
1-(diethylamino)-6-(3-methoxyphenyl)hexan-3-one;nitroxyl (PubChem CID 86733483) has the molecular formula C17H28N2O3
and a molecular weight of 308.42 g/mol. Its IUPAC name is 1-(diethylamino)-6-(3-methoxyphenyl)hexan-3-one;nitroxyl.
Molecular Properties
| Compound Name | 1-(diethylamino)-6-(3-methoxyphenyl)hexan-3-one;nitroxyl |
| PubChem CID | 86733483 |
| Molecular Formula | C17H28N2O3 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | 1-(diethylamino)-6-(3-methoxyphenyl)hexan-3-one;nitroxyl |
| SMILES | CCN(CC)CCC(=O)CCCc1cccc(OC)c1.N=O |
| InChI | InChI=1S/C17H27NO2.HNO/c1-4-18(5-2)13-12-16(19)10-6-8-15-9-7-11-17(14-15)20-3;1-2/h7,9,11,14H,4-6,8,10,12-13H2,1-3H3;1H |
| InChIKey | DGBRBNFNPPWSLH-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 70.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(diethylamino)-6-(3-methoxyphenyl)hexan-3-one;nitroxyl with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(diethylamino)-6-(3-methoxyphenyl)hexan-3-one;nitroxyl?
The IUPAC name of 1-(diethylamino)-6-(3-methoxyphenyl)hexan-3-one;nitroxyl (CID 86733483) is 1-(diethylamino)-6-(3-methoxyphenyl)hexan-3-one;nitroxyl.
What is the SMILES notation for 1-(diethylamino)-6-(3-methoxyphenyl)hexan-3-one;nitroxyl?
The canonical SMILES for 1-(diethylamino)-6-(3-methoxyphenyl)hexan-3-one;nitroxyl is CCN(CC)CCC(=O)CCCc1cccc(OC)c1.N=O.
What is the InChIKey of 1-(diethylamino)-6-(3-methoxyphenyl)hexan-3-one;nitroxyl?
The InChIKey is DGBRBNFNPPWSLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27NO2.HNO/c1-4-18(5-2)13-12-16(19)10-6-8-15-9-7-11-17(14-15)20-3;1-2/h7,9,11,14H,4-6,8,10,12-13H2,1-3H3;1H.
What are the key properties of 1-(diethylamino)-6-(3-methoxyphenyl)hexan-3-one;nitroxyl?
1-(diethylamino)-6-(3-methoxyphenyl)hexan-3-one;nitroxyl has a molecular weight of 308.42 g/mol, XLogP of 3.65, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(diethylamino)-6-(3-methoxyphenyl)hexan-3-one;nitroxyl is sourced from PubChem (CID 86733483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).