C17H28N2O3 — CID 86733483
1-(diethylamino)-6-(3-methoxyphenyl)hexan-3-one;nitroxyl (PubChem CID 86733483) has the molecular formula C17H28N2O3 and a molecular weight of 308.42 g/mol. Its IUPAC name is 1-(diethylamino)-6-(3-methoxyphenyl)hexan-3-one;nitroxyl.
| Compound Name | 1-(diethylamino)-6-(3-methoxyphenyl)hexan-3-one;nitroxyl |
|---|---|
| PubChem CID | 86733483 |
| Molecular Formula | C17H28N2O3 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | 1-(diethylamino)-6-(3-methoxyphenyl)hexan-3-one;nitroxyl |
| SMILES | CCN(CC)CCC(=O)CCCc1cccc(OC)c1.N=O |
| InChI | InChI=1S/C17H27NO2.HNO/c1-4-18(5-2)13-12-16(19)10-6-8-15-9-7-11-17(14-15)20-3;1-2/h7,9,11,14H,4-6,8,10,12-13H2,1-3H3;1H |
| InChIKey | DGBRBNFNPPWSLH-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 70.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |