C22H30O4 — CID 21485618
2-[6-(3-methoxyphenyl)-3-oxohexyl]-2-propylcyclohexane-1,3-dione (PubChem CID 21485618) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is 2-[6-(3-methoxyphenyl)-3-oxohexyl]-2-propylcyclohexane-1,3-dione.
| Compound Name | 2-[6-(3-methoxyphenyl)-3-oxohexyl]-2-propylcyclohexane-1,3-dione |
|---|---|
| PubChem CID | 21485618 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | 2-[6-(3-methoxyphenyl)-3-oxohexyl]-2-propylcyclohexane-1,3-dione |
| SMILES | CCCC1(CCC(=O)CCCc2cccc(OC)c2)C(=O)CCCC1=O |
| InChI | InChI=1S/C22H30O4/c1-3-14-22(20(24)11-6-12-21(22)25)15-13-18(23)9-4-7-17-8-5-10-19(16-17)26-2/h5,8,10,16H,3-4,6-7,9,11-15H2,1-2H3 |
| InChIKey | KDTUFVJOUSQJAN-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|