C21H28O4 — CID 21485528
2-[6-(3-methoxyphenyl)-3-oxohexyl]-2-propylcyclopentane-1,3-dione (PubChem CID 21485528) has the molecular formula C21H28O4 and a molecular weight of 344.45 g/mol. Its IUPAC name is 2-[6-(3-methoxyphenyl)-3-oxohexyl]-2-propylcyclopentane-1,3-dione.
| Compound Name | 2-[6-(3-methoxyphenyl)-3-oxohexyl]-2-propylcyclopentane-1,3-dione |
|---|---|
| PubChem CID | 21485528 |
| Molecular Formula | C21H28O4 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 2-[6-(3-methoxyphenyl)-3-oxohexyl]-2-propylcyclopentane-1,3-dione |
| SMILES | CCCC1(CCC(=O)CCCc2cccc(OC)c2)C(=O)CCC1=O |
| InChI | InChI=1S/C21H28O4/c1-3-13-21(19(23)10-11-20(21)24)14-12-17(22)8-4-6-16-7-5-9-18(15-16)25-2/h5,7,9,15H,3-4,6,8,10-14H2,1-2H3 |
| InChIKey | NJZGFUUVHQZZDR-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|