C49H55N3O14 — CID 164739457
bis[2-[2-[bis[(3-methoxyphenyl)methyl]carbamoyloxy]ethoxy]ethyl] pyridine-2,6-dicarboxylate (PubChem CID 164739457) has the molecular formula C49H55N3O14 and a molecular weight of 909.99 g/mol. Its IUPAC name is bis[2-[2-[bis[(3-methoxyphenyl)methyl]carbamoyloxy]ethoxy]ethyl] pyridine-2,6-dicarboxylate.
| Compound Name | bis[2-[2-[bis[(3-methoxyphenyl)methyl]carbamoyloxy]ethoxy]ethyl] pyridine-2,6-dicarboxylate |
|---|---|
| PubChem CID | 164739457 |
| Molecular Formula | C49H55N3O14 |
| Molecular Weight | 909.99 g/mol |
| Exact Mass | 909.37 |
| IUPAC Name | bis[2-[2-[bis[(3-methoxyphenyl)methyl]carbamoyloxy]ethoxy]ethyl] pyridine-2,6-dicarboxylate |
| SMILES | COc1cccc(CN(Cc2cccc(OC)c2)C(=O)OCCOCCOC(=O)c2cccc(C(=O)OCCOCCOC(=O)N(Cc3cccc(OC)c3)Cc3cccc(OC)c3)n2)c1 |
| InChI | InChI=1S/C49H55N3O14/c1-57-40-14-5-10-36(28-40)32-51(33-37-11-6-15-41(29-37)58-2)48(55)65-26-22-61-20-24-63-46(53)44-18-9-19-45(50-44)47(54)64-25-21-62-23-27-66-49(56)52(34-38-12-7-16-42(30-38)59-3)35-39-13-8-17-43(31-39)60-4/h5-19,28-31H,20-27,32-35H2,1-4H3 |
| InChIKey | MQUDEXPGZIZCRO-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 179.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 909.99 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|