C41H43N3O10 — CID 170312631
[[bis[(3-methoxyphenyl)methyl]amino]-[[6-[bis[(3-methoxyphenyl)methyl]carbamoyloxymethoxy]-2-pyridinyl]oxy]methyl] formate (PubChem CID 170312631) has the molecular formula C41H43N3O10 and a molecular weight of 737.81 g/mol. Its IUPAC name is [[bis[(3-methoxyphenyl)methyl]amino]-[[6-[bis[(3-methoxyphenyl)methyl]carbamoyloxymethoxy]-2-pyridinyl]oxy]methyl] formate.
| Compound Name | [[bis[(3-methoxyphenyl)methyl]amino]-[[6-[bis[(3-methoxyphenyl)methyl]carbamoyloxymethoxy]-2-pyridinyl]oxy]methyl] formate |
|---|---|
| PubChem CID | 170312631 |
| Molecular Formula | C41H43N3O10 |
| Molecular Weight | 737.81 g/mol |
| Exact Mass | 737.29 |
| IUPAC Name | [[bis[(3-methoxyphenyl)methyl]amino]-[[6-[bis[(3-methoxyphenyl)methyl]carbamoyloxymethoxy]-2-pyridinyl]oxy]methyl] formate |
| SMILES | COc1cccc(CN(Cc2cccc(OC)c2)C(=O)OCOc2cccc(OC(OC=O)N(Cc3cccc(OC)c3)Cc3cccc(OC)c3)n2)c1 |
| InChI | InChI=1S/C41H43N3O10/c1-47-34-14-5-10-30(20-34)24-43(25-31-11-6-15-35(21-31)48-2)40(46)53-29-52-38-18-9-19-39(42-38)54-41(51-28-45)44(26-32-12-7-16-36(22-32)49-3)27-33-13-8-17-37(23-33)50-4/h5-23,28,41H,24-27,29H2,1-4H3 |
| InChIKey | NTTLGECGKBCOCK-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 127.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.81 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|