C46H53N3O12 — CID 170312628
[[bis[(3-methoxyphenyl)methyl]amino]-[3-[bis[(3-methoxyphenyl)methyl]carbamoyloxymethoxymethoxy]-5-(dimethylamino)phenoxy]methoxy]methyl formate (PubChem CID 170312628) has the molecular formula C46H53N3O12 and a molecular weight of 839.94 g/mol. Its IUPAC name is [[bis[(3-methoxyphenyl)methyl]amino]-[3-[bis[(3-methoxyphenyl)methyl]carbamoyloxymethoxymethoxy]-5-(dimethylamino)phenoxy]methoxy]methyl formate.
| Compound Name | [[bis[(3-methoxyphenyl)methyl]amino]-[3-[bis[(3-methoxyphenyl)methyl]carbamoyloxymethoxymethoxy]-5-(dimethylamino)phenoxy]methoxy]methyl formate |
|---|---|
| PubChem CID | 170312628 |
| Molecular Formula | C46H53N3O12 |
| Molecular Weight | 839.94 g/mol |
| Exact Mass | 839.36 |
| IUPAC Name | [[bis[(3-methoxyphenyl)methyl]amino]-[3-[bis[(3-methoxyphenyl)methyl]carbamoyloxymethoxymethoxy]-5-(dimethylamino)phenoxy]methoxy]methyl formate |
| SMILES | COc1cccc(CN(Cc2cccc(OC)c2)C(=O)OCOCOc2cc(OC(OCOC=O)N(Cc3cccc(OC)c3)Cc3cccc(OC)c3)cc(N(C)C)c2)c1 |
| InChI | InChI=1S/C46H53N3O12/c1-47(2)38-23-43(58-32-57-33-59-45(51)48(26-34-11-7-15-39(19-34)52-3)27-35-12-8-16-40(20-35)53-4)25-44(24-38)61-46(60-31-56-30-50)49(28-36-13-9-17-41(21-36)54-5)29-37-14-10-18-42(22-37)55-6/h7-25,30,46H,26-29,31-33H2,1-6H3 |
| InChIKey | WXIDAFALDFQCFE-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 136.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 839.94 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|