C34H41N3O3 — CID 167466319
3-[[4-[2-[3-(dimethylamino)phenoxy]ethoxymethyl]-N-[(3-methoxyphenyl)methyl]anilino]methyl]-N,N-dimethylaniline (PubChem CID 167466319) has the molecular formula C34H41N3O3 and a molecular weight of 539.72 g/mol. Its IUPAC name is 3-[[4-[2-[3-(dimethylamino)phenoxy]ethoxymethyl]-N-[(3-methoxyphenyl)methyl]anilino]methyl]-N,N-dimethylaniline.
| Compound Name | 3-[[4-[2-[3-(dimethylamino)phenoxy]ethoxymethyl]-N-[(3-methoxyphenyl)methyl]anilino]methyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 167466319 |
| Molecular Formula | C34H41N3O3 |
| Molecular Weight | 539.72 g/mol |
| Exact Mass | 539.31 |
| IUPAC Name | 3-[[4-[2-[3-(dimethylamino)phenoxy]ethoxymethyl]-N-[(3-methoxyphenyl)methyl]anilino]methyl]-N,N-dimethylaniline |
| SMILES | COc1cccc(CN(Cc2cccc(N(C)C)c2)c2ccc(COCCOc3cccc(N(C)C)c3)cc2)c1 |
| InChI | InChI=1S/C34H41N3O3/c1-35(2)31-11-6-9-28(21-31)24-37(25-29-10-7-13-33(22-29)38-5)30-17-15-27(16-18-30)26-39-19-20-40-34-14-8-12-32(23-34)36(3)4/h6-18,21-23H,19-20,24-26H2,1-5H3 |
| InChIKey | PGFRGFBPNWFSDX-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 37.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.72 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|