C35H38N4O3 — CID 167465647
3-[2-[[4-[(3-imidazol-1-ylphenyl)methyl-[(3-methoxyphenyl)methyl]amino]phenyl]methoxy]ethoxy]-N,N-dimethylaniline (PubChem CID 167465647) has the molecular formula C35H38N4O3 and a molecular weight of 562.71 g/mol. Its IUPAC name is 3-[2-[[4-[(3-imidazol-1-ylphenyl)methyl-[(3-methoxyphenyl)methyl]amino]phenyl]methoxy]ethoxy]-N,N-dimethylaniline.
| Compound Name | 3-[2-[[4-[(3-imidazol-1-ylphenyl)methyl-[(3-methoxyphenyl)methyl]amino]phenyl]methoxy]ethoxy]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 167465647 |
| Molecular Formula | C35H38N4O3 |
| Molecular Weight | 562.71 g/mol |
| Exact Mass | 562.29 |
| IUPAC Name | 3-[2-[[4-[(3-imidazol-1-ylphenyl)methyl-[(3-methoxyphenyl)methyl]amino]phenyl]methoxy]ethoxy]-N,N-dimethylaniline |
| SMILES | COc1cccc(CN(Cc2cccc(-n3ccnc3)c2)c2ccc(COCCOc3cccc(N(C)C)c3)cc2)c1 |
| InChI | InChI=1S/C35H38N4O3/c1-37(2)32-9-6-12-35(23-32)42-20-19-41-26-28-13-15-31(16-14-28)39(25-30-8-5-11-34(22-30)40-3)24-29-7-4-10-33(21-29)38-18-17-36-27-38/h4-18,21-23,27H,19-20,24-26H2,1-3H3 |
| InChIKey | WCUFLDVMJPULFZ-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 51.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.71 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|