C35H37N3O5 — CID 167465198
3-[2-[2-(3-methoxyphenoxy)ethoxy]ethoxy]-N-[(3-methoxyphenyl)methyl]-N-[(4-pyrazol-1-ylphenyl)methyl]aniline (PubChem CID 167465198) has the molecular formula C35H37N3O5 and a molecular weight of 579.70 g/mol. Its IUPAC name is 3-[2-[2-(3-methoxyphenoxy)ethoxy]ethoxy]-N-[(3-methoxyphenyl)methyl]-N-[(4-pyrazol-1-ylphenyl)methyl]aniline.
| Compound Name | 3-[2-[2-(3-methoxyphenoxy)ethoxy]ethoxy]-N-[(3-methoxyphenyl)methyl]-N-[(4-pyrazol-1-ylphenyl)methyl]aniline |
|---|---|
| PubChem CID | 167465198 |
| Molecular Formula | C35H37N3O5 |
| Molecular Weight | 579.70 g/mol |
| Exact Mass | 579.27 |
| IUPAC Name | 3-[2-[2-(3-methoxyphenoxy)ethoxy]ethoxy]-N-[(3-methoxyphenyl)methyl]-N-[(4-pyrazol-1-ylphenyl)methyl]aniline |
| SMILES | COc1cccc(CN(Cc2ccc(-n3cccn3)cc2)c2cccc(OCCOCCOc3cccc(OC)c3)c2)c1 |
| InChI | InChI=1S/C35H37N3O5/c1-39-32-9-3-7-29(23-32)27-37(26-28-13-15-30(16-14-28)38-18-6-17-36-38)31-8-4-11-34(24-31)42-21-19-41-20-22-43-35-12-5-10-33(25-35)40-2/h3-18,23-25H,19-22,26-27H2,1-2H3 |
| InChIKey | NEHZRVJYKJSPGY-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 67.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.70 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|