C33H38N2O6 — CID 167466330
2-[2-[2-(3-methoxyphenoxy)ethoxy]ethoxymethyl]-N,N-bis[(3-methoxyphenyl)methyl]pyridin-4-amine (PubChem CID 167466330) has the molecular formula C33H38N2O6 and a molecular weight of 558.68 g/mol. Its IUPAC name is 2-[2-[2-(3-methoxyphenoxy)ethoxy]ethoxymethyl]-N,N-bis[(3-methoxyphenyl)methyl]pyridin-4-amine.
| Compound Name | 2-[2-[2-(3-methoxyphenoxy)ethoxy]ethoxymethyl]-N,N-bis[(3-methoxyphenyl)methyl]pyridin-4-amine |
|---|---|
| PubChem CID | 167466330 |
| Molecular Formula | C33H38N2O6 |
| Molecular Weight | 558.68 g/mol |
| Exact Mass | 558.27 |
| IUPAC Name | 2-[2-[2-(3-methoxyphenoxy)ethoxy]ethoxymethyl]-N,N-bis[(3-methoxyphenyl)methyl]pyridin-4-amine |
| SMILES | COc1cccc(CN(Cc2cccc(OC)c2)c2ccnc(COCCOCCOc3cccc(OC)c3)c2)c1 |
| InChI | InChI=1S/C33H38N2O6/c1-36-30-9-4-7-26(19-30)23-35(24-27-8-5-10-31(20-27)37-2)29-13-14-34-28(21-29)25-40-16-15-39-17-18-41-33-12-6-11-32(22-33)38-3/h4-14,19-22H,15-18,23-25H2,1-3H3 |
| InChIKey | FRDOMGJUPRBGML-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 71.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.68 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|