C29H32N2O5S — CID 167465417
4-[2-(3-methoxyphenoxy)ethoxymethyl]-N,N-bis[(3-methoxyphenyl)methyl]-1,3-thiazol-2-amine (PubChem CID 167465417) has the molecular formula C29H32N2O5S and a molecular weight of 520.65 g/mol. Its IUPAC name is 4-[2-(3-methoxyphenoxy)ethoxymethyl]-N,N-bis[(3-methoxyphenyl)methyl]-1,3-thiazol-2-amine.
| Compound Name | 4-[2-(3-methoxyphenoxy)ethoxymethyl]-N,N-bis[(3-methoxyphenyl)methyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 167465417 |
| Molecular Formula | C29H32N2O5S |
| Molecular Weight | 520.65 g/mol |
| Exact Mass | 520.20 |
| IUPAC Name | 4-[2-(3-methoxyphenoxy)ethoxymethyl]-N,N-bis[(3-methoxyphenyl)methyl]-1,3-thiazol-2-amine |
| SMILES | COc1cccc(CN(Cc2cccc(OC)c2)c2nc(COCCOc3cccc(OC)c3)cs2)c1 |
| InChI | InChI=1S/C29H32N2O5S/c1-32-25-9-4-7-22(15-25)18-31(19-23-8-5-10-26(16-23)33-2)29-30-24(21-37-29)20-35-13-14-36-28-12-6-11-27(17-28)34-3/h4-12,15-17,21H,13-14,18-20H2,1-3H3 |
| InChIKey | KGCMXWRMVSUFHV-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 62.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.65 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|