C27H36N4O3S — CID 167465485
N,N-bis[(3-methoxyphenyl)methyl]-4-[2-(4-methylpiperazin-1-yl)ethoxymethyl]-1,3-thiazol-2-amine (PubChem CID 167465485) has the molecular formula C27H36N4O3S and a molecular weight of 496.68 g/mol. Its IUPAC name is N,N-bis[(3-methoxyphenyl)methyl]-4-[2-(4-methylpiperazin-1-yl)ethoxymethyl]-1,3-thiazol-2-amine.
| Compound Name | N,N-bis[(3-methoxyphenyl)methyl]-4-[2-(4-methylpiperazin-1-yl)ethoxymethyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 167465485 |
| Molecular Formula | C27H36N4O3S |
| Molecular Weight | 496.68 g/mol |
| Exact Mass | 496.25 |
| IUPAC Name | N,N-bis[(3-methoxyphenyl)methyl]-4-[2-(4-methylpiperazin-1-yl)ethoxymethyl]-1,3-thiazol-2-amine |
| SMILES | COc1cccc(CN(Cc2cccc(OC)c2)c2nc(COCCN3CCN(C)CC3)cs2)c1 |
| InChI | InChI=1S/C27H36N4O3S/c1-29-10-12-30(13-11-29)14-15-34-20-24-21-35-27(28-24)31(18-22-6-4-8-25(16-22)32-2)19-23-7-5-9-26(17-23)33-3/h4-9,16-17,21H,10-15,18-20H2,1-3H3 |
| InChIKey | NWRDNGRBCIWWAK-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 50.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.68 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|