C31H36N2O5S — CID 167465397
N,N-bis[(3-methoxyphenyl)methyl]-4-[2-(2-phenylmethoxyethoxy)ethoxymethyl]-1,3-thiazol-2-amine (PubChem CID 167465397) has the molecular formula C31H36N2O5S and a molecular weight of 548.71 g/mol. Its IUPAC name is N,N-bis[(3-methoxyphenyl)methyl]-4-[2-(2-phenylmethoxyethoxy)ethoxymethyl]-1,3-thiazol-2-amine.
| Compound Name | N,N-bis[(3-methoxyphenyl)methyl]-4-[2-(2-phenylmethoxyethoxy)ethoxymethyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 167465397 |
| Molecular Formula | C31H36N2O5S |
| Molecular Weight | 548.71 g/mol |
| Exact Mass | 548.23 |
| IUPAC Name | N,N-bis[(3-methoxyphenyl)methyl]-4-[2-(2-phenylmethoxyethoxy)ethoxymethyl]-1,3-thiazol-2-amine |
| SMILES | COc1cccc(CN(Cc2cccc(OC)c2)c2nc(COCCOCCOCc3ccccc3)cs2)c1 |
| InChI | InChI=1S/C31H36N2O5S/c1-34-29-12-6-10-26(18-29)20-33(21-27-11-7-13-30(19-27)35-2)31-32-28(24-39-31)23-38-17-15-36-14-16-37-22-25-8-4-3-5-9-25/h3-13,18-19,24H,14-17,20-23H2,1-2H3 |
| InChIKey | FYFXZVOWYKCDTB-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 62.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.71 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|