C33H38N2O5 — CID 167465242
N,N-bis[(3-methoxyphenyl)methyl]-2-[2-(2-phenylmethoxyethoxy)ethoxymethyl]pyridin-4-amine (PubChem CID 167465242) has the molecular formula C33H38N2O5 and a molecular weight of 542.68 g/mol. Its IUPAC name is N,N-bis[(3-methoxyphenyl)methyl]-2-[2-(2-phenylmethoxyethoxy)ethoxymethyl]pyridin-4-amine.
| Compound Name | N,N-bis[(3-methoxyphenyl)methyl]-2-[2-(2-phenylmethoxyethoxy)ethoxymethyl]pyridin-4-amine |
|---|---|
| PubChem CID | 167465242 |
| Molecular Formula | C33H38N2O5 |
| Molecular Weight | 542.68 g/mol |
| Exact Mass | 542.28 |
| IUPAC Name | N,N-bis[(3-methoxyphenyl)methyl]-2-[2-(2-phenylmethoxyethoxy)ethoxymethyl]pyridin-4-amine |
| SMILES | COc1cccc(CN(Cc2cccc(OC)c2)c2ccnc(COCCOCCOCc3ccccc3)c2)c1 |
| InChI | InChI=1S/C33H38N2O5/c1-36-32-12-6-10-28(20-32)23-35(24-29-11-7-13-33(21-29)37-2)31-14-15-34-30(22-31)26-40-19-17-38-16-18-39-25-27-8-4-3-5-9-27/h3-15,20-22H,16-19,23-26H2,1-2H3 |
| InChIKey | UJIPRPXSHXIASB-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 62.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.68 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|