C33H37NO5 — CID 167466346
N,N-bis[(3-methoxyphenyl)methyl]-4-[2-(2-phenylmethoxyethoxy)ethoxy]aniline (PubChem CID 167466346) has the molecular formula C33H37NO5 and a molecular weight of 527.66 g/mol. Its IUPAC name is N,N-bis[(3-methoxyphenyl)methyl]-4-[2-(2-phenylmethoxyethoxy)ethoxy]aniline.
| Compound Name | N,N-bis[(3-methoxyphenyl)methyl]-4-[2-(2-phenylmethoxyethoxy)ethoxy]aniline |
|---|---|
| PubChem CID | 167466346 |
| Molecular Formula | C33H37NO5 |
| Molecular Weight | 527.66 g/mol |
| Exact Mass | 527.27 |
| IUPAC Name | N,N-bis[(3-methoxyphenyl)methyl]-4-[2-(2-phenylmethoxyethoxy)ethoxy]aniline |
| SMILES | COc1cccc(CN(Cc2cccc(OC)c2)c2ccc(OCCOCCOCc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C33H37NO5/c1-35-32-12-6-10-28(22-32)24-34(25-29-11-7-13-33(23-29)36-2)30-14-16-31(17-15-30)39-21-20-37-18-19-38-26-27-8-4-3-5-9-27/h3-17,22-23H,18-21,24-26H2,1-2H3 |
| InChIKey | VABODAAAZPZYBJ-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.66 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|