C32H36N2O5 — CID 171483692
N,N-bis[(3-methoxyphenyl)methyl]-2-[2-(2-phenylmethoxyethoxy)ethoxy]pyridin-4-amine (PubChem CID 171483692) has the molecular formula C32H36N2O5 and a molecular weight of 528.65 g/mol. Its IUPAC name is N,N-bis[(3-methoxyphenyl)methyl]-2-[2-(2-phenylmethoxyethoxy)ethoxy]pyridin-4-amine.
| Compound Name | N,N-bis[(3-methoxyphenyl)methyl]-2-[2-(2-phenylmethoxyethoxy)ethoxy]pyridin-4-amine |
|---|---|
| PubChem CID | 171483692 |
| Molecular Formula | C32H36N2O5 |
| Molecular Weight | 528.65 g/mol |
| Exact Mass | 528.26 |
| IUPAC Name | N,N-bis[(3-methoxyphenyl)methyl]-2-[2-(2-phenylmethoxyethoxy)ethoxy]pyridin-4-amine |
| SMILES | COc1cccc(CN(Cc2cccc(OC)c2)c2ccnc(OCCOCCOCc3ccccc3)c2)c1 |
| InChI | InChI=1S/C32H36N2O5/c1-35-30-12-6-10-27(20-30)23-34(24-28-11-7-13-31(21-28)36-2)29-14-15-33-32(22-29)39-19-18-37-16-17-38-25-26-8-4-3-5-9-26/h3-15,20-22H,16-19,23-25H2,1-2H3 |
| InChIKey | RWGXBCRWXMLBIN-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 62.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.65 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|