C35H37N3O4 — CID 167465674
N-[(3-methoxyphenyl)methyl]-3-[2-(2-phenylmethoxyethoxy)ethoxy]-N-[(4-pyrazol-1-ylphenyl)methyl]aniline (PubChem CID 167465674) has the molecular formula C35H37N3O4 and a molecular weight of 563.70 g/mol. Its IUPAC name is N-[(3-methoxyphenyl)methyl]-3-[2-(2-phenylmethoxyethoxy)ethoxy]-N-[(4-pyrazol-1-ylphenyl)methyl]aniline.
| Compound Name | N-[(3-methoxyphenyl)methyl]-3-[2-(2-phenylmethoxyethoxy)ethoxy]-N-[(4-pyrazol-1-ylphenyl)methyl]aniline |
|---|---|
| PubChem CID | 167465674 |
| Molecular Formula | C35H37N3O4 |
| Molecular Weight | 563.70 g/mol |
| Exact Mass | 563.28 |
| IUPAC Name | N-[(3-methoxyphenyl)methyl]-3-[2-(2-phenylmethoxyethoxy)ethoxy]-N-[(4-pyrazol-1-ylphenyl)methyl]aniline |
| SMILES | COc1cccc(CN(Cc2ccc(-n3cccn3)cc2)c2cccc(OCCOCCOCc3ccccc3)c2)c1 |
| InChI | InChI=1S/C35H37N3O4/c1-39-34-12-5-10-31(24-34)27-37(26-29-14-16-32(17-15-29)38-19-7-18-36-38)33-11-6-13-35(25-33)42-23-22-40-20-21-41-28-30-8-3-2-4-9-30/h2-19,24-25H,20-23,26-28H2,1H3 |
| InChIKey | SFWOUGIJIAXSDY-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 57.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.70 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|