C33H35N3O5 — CID 167465588
N-(3H-benzimidazol-5-ylmethyl)-3-[2-[2-(3-methoxyphenoxy)ethoxy]ethoxy]-N-[(3-methoxyphenyl)methyl]aniline (PubChem CID 167465588) has the molecular formula C33H35N3O5 and a molecular weight of 553.66 g/mol. Its IUPAC name is N-(3H-benzimidazol-5-ylmethyl)-3-[2-[2-(3-methoxyphenoxy)ethoxy]ethoxy]-N-[(3-methoxyphenyl)methyl]aniline.
| Compound Name | N-(3H-benzimidazol-5-ylmethyl)-3-[2-[2-(3-methoxyphenoxy)ethoxy]ethoxy]-N-[(3-methoxyphenyl)methyl]aniline |
|---|---|
| PubChem CID | 167465588 |
| Molecular Formula | C33H35N3O5 |
| Molecular Weight | 553.66 g/mol |
| Exact Mass | 553.26 |
| IUPAC Name | N-(3H-benzimidazol-5-ylmethyl)-3-[2-[2-(3-methoxyphenoxy)ethoxy]ethoxy]-N-[(3-methoxyphenyl)methyl]aniline |
| SMILES | COc1cccc(CN(Cc2ccc3nc[nH]c3c2)c2cccc(OCCOCCOc3cccc(OC)c3)c2)c1 |
| InChI | InChI=1S/C33H35N3O5/c1-37-28-8-3-6-25(18-28)22-36(23-26-12-13-32-33(19-26)35-24-34-32)27-7-4-10-30(20-27)40-16-14-39-15-17-41-31-11-5-9-29(21-31)38-2/h3-13,18-21,24H,14-17,22-23H2,1-2H3,(H,34,35) |
| InChIKey | ICAYHZVFTAMLAQ-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 78.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.66 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|