C33H43N3O4 — CID 167465345
N-[(3-methoxyphenyl)methyl]-3-[2-(2-morpholin-4-ylethoxy)ethoxy]-N-[(3-pyrrolidin-1-ylphenyl)methyl]aniline (PubChem CID 167465345) has the molecular formula C33H43N3O4 and a molecular weight of 545.72 g/mol. Its IUPAC name is N-[(3-methoxyphenyl)methyl]-3-[2-(2-morpholin-4-ylethoxy)ethoxy]-N-[(3-pyrrolidin-1-ylphenyl)methyl]aniline.
| Compound Name | N-[(3-methoxyphenyl)methyl]-3-[2-(2-morpholin-4-ylethoxy)ethoxy]-N-[(3-pyrrolidin-1-ylphenyl)methyl]aniline |
|---|---|
| PubChem CID | 167465345 |
| Molecular Formula | C33H43N3O4 |
| Molecular Weight | 545.72 g/mol |
| Exact Mass | 545.33 |
| IUPAC Name | N-[(3-methoxyphenyl)methyl]-3-[2-(2-morpholin-4-ylethoxy)ethoxy]-N-[(3-pyrrolidin-1-ylphenyl)methyl]aniline |
| SMILES | COc1cccc(CN(Cc2cccc(N3CCCC3)c2)c2cccc(OCCOCCN3CCOCC3)c2)c1 |
| InChI | InChI=1S/C33H43N3O4/c1-37-32-11-5-8-29(24-32)27-36(26-28-7-4-9-30(23-28)35-13-2-3-14-35)31-10-6-12-33(25-31)40-22-21-39-20-17-34-15-18-38-19-16-34/h4-12,23-25H,2-3,13-22,26-27H2,1H3 |
| InChIKey | CNZQPKGGCXPXHQ-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 46.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.72 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|