C29H34N4O3 — CID 167465475
N-(1H-indazol-6-ylmethyl)-N-[(3-methoxyphenyl)methyl]-3-(2-morpholin-4-ylethoxymethyl)aniline (PubChem CID 167465475) has the molecular formula C29H34N4O3 and a molecular weight of 486.62 g/mol. Its IUPAC name is N-(1H-indazol-6-ylmethyl)-N-[(3-methoxyphenyl)methyl]-3-(2-morpholin-4-ylethoxymethyl)aniline.
| Compound Name | N-(1H-indazol-6-ylmethyl)-N-[(3-methoxyphenyl)methyl]-3-(2-morpholin-4-ylethoxymethyl)aniline |
|---|---|
| PubChem CID | 167465475 |
| Molecular Formula | C29H34N4O3 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | N-(1H-indazol-6-ylmethyl)-N-[(3-methoxyphenyl)methyl]-3-(2-morpholin-4-ylethoxymethyl)aniline |
| SMILES | COc1cccc(CN(Cc2ccc3cn[nH]c3c2)c2cccc(COCCN3CCOCC3)c2)c1 |
| InChI | InChI=1S/C29H34N4O3/c1-34-28-7-3-4-23(17-28)20-33(21-24-8-9-26-19-30-31-29(26)18-24)27-6-2-5-25(16-27)22-36-15-12-32-10-13-35-14-11-32/h2-9,16-19H,10-15,20-22H2,1H3,(H,30,31) |
| InChIKey | YEYVQHJCQNZLNI-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 62.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|