C27H29N5O2 — CID 167465202
4-[[3-[1H-indazol-6-ylmethyl-[(3-methoxyphenyl)methyl]amino]phenyl]methyl]piperazin-2-one (PubChem CID 167465202) has the molecular formula C27H29N5O2 and a molecular weight of 455.56 g/mol. Its IUPAC name is 4-[[3-[1H-indazol-6-ylmethyl-[(3-methoxyphenyl)methyl]amino]phenyl]methyl]piperazin-2-one.
| Compound Name | 4-[[3-[1H-indazol-6-ylmethyl-[(3-methoxyphenyl)methyl]amino]phenyl]methyl]piperazin-2-one |
|---|---|
| PubChem CID | 167465202 |
| Molecular Formula | C27H29N5O2 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | 4-[[3-[1H-indazol-6-ylmethyl-[(3-methoxyphenyl)methyl]amino]phenyl]methyl]piperazin-2-one |
| SMILES | COc1cccc(CN(Cc2ccc3cn[nH]c3c2)c2cccc(CN3CCNC(=O)C3)c2)c1 |
| InChI | InChI=1S/C27H29N5O2/c1-34-25-7-3-5-21(13-25)17-32(18-22-8-9-23-15-29-30-26(23)14-22)24-6-2-4-20(12-24)16-31-11-10-28-27(33)19-31/h2-9,12-15H,10-11,16-19H2,1H3,(H,28,33)(H,29,30) |
| InChIKey | BCZSHMUVTOIOTM-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 73.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |