C29H34N4O3 — CID 175547237
4-[[4-[N-[(3-methoxyphenyl)methyl]-3-morpholin-4-ylanilino]phenyl]methyl]piperazin-2-one (PubChem CID 175547237) has the molecular formula C29H34N4O3 and a molecular weight of 486.62 g/mol. Its IUPAC name is 4-[[4-[N-[(3-methoxyphenyl)methyl]-3-morpholin-4-ylanilino]phenyl]methyl]piperazin-2-one.
| Compound Name | 4-[[4-[N-[(3-methoxyphenyl)methyl]-3-morpholin-4-ylanilino]phenyl]methyl]piperazin-2-one |
|---|---|
| PubChem CID | 175547237 |
| Molecular Formula | C29H34N4O3 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | 4-[[4-[N-[(3-methoxyphenyl)methyl]-3-morpholin-4-ylanilino]phenyl]methyl]piperazin-2-one |
| SMILES | COc1cccc(CN(c2ccc(CN3CCNC(=O)C3)cc2)c2cccc(N3CCOCC3)c2)c1 |
| InChI | InChI=1S/C29H34N4O3/c1-35-28-7-2-4-24(18-28)21-33(27-6-3-5-26(19-27)32-14-16-36-17-15-32)25-10-8-23(9-11-25)20-31-13-12-30-29(34)22-31/h2-11,18-19H,12-17,20-22H2,1H3,(H,30,34) |
| InChIKey | GKNRYRMEKNDIHJ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 57.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |