C31H40N4O2 — CID 167465477
N-[(3-methoxyphenyl)methyl]-N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]-4-(morpholin-4-ylmethyl)aniline (PubChem CID 167465477) has the molecular formula C31H40N4O2 and a molecular weight of 500.69 g/mol. Its IUPAC name is N-[(3-methoxyphenyl)methyl]-N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]-4-(morpholin-4-ylmethyl)aniline.
| Compound Name | N-[(3-methoxyphenyl)methyl]-N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]-4-(morpholin-4-ylmethyl)aniline |
|---|---|
| PubChem CID | 167465477 |
| Molecular Formula | C31H40N4O2 |
| Molecular Weight | 500.69 g/mol |
| Exact Mass | 500.32 |
| IUPAC Name | N-[(3-methoxyphenyl)methyl]-N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]-4-(morpholin-4-ylmethyl)aniline |
| SMILES | COc1cccc(CN(Cc2ccc(N3CCN(C)CC3)cc2)c2ccc(CN3CCOCC3)cc2)c1 |
| InChI | InChI=1S/C31H40N4O2/c1-32-14-16-34(17-15-32)29-10-8-27(9-11-29)24-35(25-28-4-3-5-31(22-28)36-2)30-12-6-26(7-13-30)23-33-18-20-37-21-19-33/h3-13,22H,14-21,23-25H2,1-2H3 |
| InChIKey | LMZVSATWUXJBDJ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 31.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.69 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|