C30H39N5O — CID 167465723
N-[(3-methoxyphenyl)methyl]-2-[(4-methylpiperazin-1-yl)methyl]-N-[(4-pyrrolidin-1-ylphenyl)methyl]pyridin-4-amine (PubChem CID 167465723) has the molecular formula C30H39N5O and a molecular weight of 485.68 g/mol. Its IUPAC name is N-[(3-methoxyphenyl)methyl]-2-[(4-methylpiperazin-1-yl)methyl]-N-[(4-pyrrolidin-1-ylphenyl)methyl]pyridin-4-amine.
| Compound Name | N-[(3-methoxyphenyl)methyl]-2-[(4-methylpiperazin-1-yl)methyl]-N-[(4-pyrrolidin-1-ylphenyl)methyl]pyridin-4-amine |
|---|---|
| PubChem CID | 167465723 |
| Molecular Formula | C30H39N5O |
| Molecular Weight | 485.68 g/mol |
| Exact Mass | 485.32 |
| IUPAC Name | N-[(3-methoxyphenyl)methyl]-2-[(4-methylpiperazin-1-yl)methyl]-N-[(4-pyrrolidin-1-ylphenyl)methyl]pyridin-4-amine |
| SMILES | COc1cccc(CN(Cc2ccc(N3CCCC3)cc2)c2ccnc(CN3CCN(C)CC3)c2)c1 |
| InChI | InChI=1S/C30H39N5O/c1-32-16-18-33(19-17-32)24-27-21-29(12-13-31-27)35(23-26-6-5-7-30(20-26)36-2)22-25-8-10-28(11-9-25)34-14-3-4-15-34/h5-13,20-21H,3-4,14-19,22-24H2,1-2H3 |
| InChIKey | XXOYGARTXRVPHC-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 35.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.68 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|