C34H42N4O5 — CID 167466170
4-[2-[(3-methoxyphenyl)methoxy]ethoxymethyl]-N-[(3-methoxyphenyl)methyl]-N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]-1,3-oxazol-2-amine (PubChem CID 167466170) has the molecular formula C34H42N4O5 and a molecular weight of 586.73 g/mol. Its IUPAC name is 4-[2-[(3-methoxyphenyl)methoxy]ethoxymethyl]-N-[(3-methoxyphenyl)methyl]-N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]-1,3-oxazol-2-amine.
| Compound Name | 4-[2-[(3-methoxyphenyl)methoxy]ethoxymethyl]-N-[(3-methoxyphenyl)methyl]-N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 167466170 |
| Molecular Formula | C34H42N4O5 |
| Molecular Weight | 586.73 g/mol |
| Exact Mass | 586.32 |
| IUPAC Name | 4-[2-[(3-methoxyphenyl)methoxy]ethoxymethyl]-N-[(3-methoxyphenyl)methyl]-N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]-1,3-oxazol-2-amine |
| SMILES | COc1cccc(COCCOCc2coc(N(Cc3ccc(N4CCN(C)CC4)cc3)Cc3cccc(OC)c3)n2)c1 |
| InChI | InChI=1S/C34H42N4O5/c1-36-14-16-37(17-15-36)31-12-10-27(11-13-31)22-38(23-28-6-4-8-32(20-28)39-2)34-35-30(26-43-34)25-42-19-18-41-24-29-7-5-9-33(21-29)40-3/h4-13,20-21,26H,14-19,22-25H2,1-3H3 |
| InChIKey | FQYIOHFTKMZGGT-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 72.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.73 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|