C36H43N3O4 — CID 167465905
3-[2-[3-(dimethylamino)phenoxy]ethoxymethyl]-N-[(3-methoxyphenyl)methyl]-N-[(3-morpholin-4-ylphenyl)methyl]aniline (PubChem CID 167465905) has the molecular formula C36H43N3O4 and a molecular weight of 581.76 g/mol. Its IUPAC name is 3-[2-[3-(dimethylamino)phenoxy]ethoxymethyl]-N-[(3-methoxyphenyl)methyl]-N-[(3-morpholin-4-ylphenyl)methyl]aniline.
| Compound Name | 3-[2-[3-(dimethylamino)phenoxy]ethoxymethyl]-N-[(3-methoxyphenyl)methyl]-N-[(3-morpholin-4-ylphenyl)methyl]aniline |
|---|---|
| PubChem CID | 167465905 |
| Molecular Formula | C36H43N3O4 |
| Molecular Weight | 581.76 g/mol |
| Exact Mass | 581.33 |
| IUPAC Name | 3-[2-[3-(dimethylamino)phenoxy]ethoxymethyl]-N-[(3-methoxyphenyl)methyl]-N-[(3-morpholin-4-ylphenyl)methyl]aniline |
| SMILES | COc1cccc(CN(Cc2cccc(N3CCOCC3)c2)c2cccc(COCCOc3cccc(N(C)C)c3)c2)c1 |
| InChI | InChI=1S/C36H43N3O4/c1-37(2)32-11-7-15-36(25-32)43-21-20-42-28-31-10-5-13-34(23-31)39(27-30-9-6-14-35(24-30)40-3)26-29-8-4-12-33(22-29)38-16-18-41-19-17-38/h4-15,22-25H,16-21,26-28H2,1-3H3 |
| InChIKey | DUSQKKRCPXHIQV-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 46.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.76 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|