C35H41N3O4 — CID 167465570
3-[2-[4-[(3-methoxyphenyl)methyl-[(4-morpholin-4-ylphenyl)methyl]amino]phenoxy]ethoxy]-N,N-dimethylaniline (PubChem CID 167465570) has the molecular formula C35H41N3O4 and a molecular weight of 567.73 g/mol. Its IUPAC name is 3-[2-[4-[(3-methoxyphenyl)methyl-[(4-morpholin-4-ylphenyl)methyl]amino]phenoxy]ethoxy]-N,N-dimethylaniline.
| Compound Name | 3-[2-[4-[(3-methoxyphenyl)methyl-[(4-morpholin-4-ylphenyl)methyl]amino]phenoxy]ethoxy]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 167465570 |
| Molecular Formula | C35H41N3O4 |
| Molecular Weight | 567.73 g/mol |
| Exact Mass | 567.31 |
| IUPAC Name | 3-[2-[4-[(3-methoxyphenyl)methyl-[(4-morpholin-4-ylphenyl)methyl]amino]phenoxy]ethoxy]-N,N-dimethylaniline |
| SMILES | COc1cccc(CN(Cc2ccc(N3CCOCC3)cc2)c2ccc(OCCOc3cccc(N(C)C)c3)cc2)c1 |
| InChI | InChI=1S/C35H41N3O4/c1-36(2)32-7-5-9-35(25-32)42-23-22-41-33-16-14-31(15-17-33)38(27-29-6-4-8-34(24-29)39-3)26-28-10-12-30(13-11-28)37-18-20-40-21-19-37/h4-17,24-25H,18-23,26-27H2,1-3H3 |
| InChIKey | XIQOBVUMNUKVKV-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 46.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.73 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|