C37H45N3O6 — CID 167465944
5-[2-[2-[(3-methoxyphenyl)methoxy]ethoxy]ethoxymethyl]-N-[(3-methoxyphenyl)methyl]-N-[(4-morpholin-4-ylphenyl)methyl]pyridin-2-amine (PubChem CID 167465944) has the molecular formula C37H45N3O6 and a molecular weight of 627.78 g/mol. Its IUPAC name is 5-[2-[2-[(3-methoxyphenyl)methoxy]ethoxy]ethoxymethyl]-N-[(3-methoxyphenyl)methyl]-N-[(4-morpholin-4-ylphenyl)methyl]pyridin-2-amine.
| Compound Name | 5-[2-[2-[(3-methoxyphenyl)methoxy]ethoxy]ethoxymethyl]-N-[(3-methoxyphenyl)methyl]-N-[(4-morpholin-4-ylphenyl)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 167465944 |
| Molecular Formula | C37H45N3O6 |
| Molecular Weight | 627.78 g/mol |
| Exact Mass | 627.33 |
| IUPAC Name | 5-[2-[2-[(3-methoxyphenyl)methoxy]ethoxy]ethoxymethyl]-N-[(3-methoxyphenyl)methyl]-N-[(4-morpholin-4-ylphenyl)methyl]pyridin-2-amine |
| SMILES | COc1cccc(COCCOCCOCc2ccc(N(Cc3ccc(N4CCOCC4)cc3)Cc3cccc(OC)c3)nc2)c1 |
| InChI | InChI=1S/C37H45N3O6/c1-41-35-7-3-5-31(23-35)27-40(26-30-9-12-34(13-10-30)39-15-17-43-18-16-39)37-14-11-33(25-38-37)29-46-22-20-44-19-21-45-28-32-6-4-8-36(24-32)42-2/h3-14,23-25H,15-22,26-29H2,1-2H3 |
| InChIKey | MVPDCMKUBMRXHE-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 74.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.78 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|