C20H25NO3 — CID 142066874
4-[4-[1-[(3-methoxyphenyl)methoxy]ethyl]phenyl]morpholine (PubChem CID 142066874) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is 4-[4-[1-[(3-methoxyphenyl)methoxy]ethyl]phenyl]morpholine.
| Compound Name | 4-[4-[1-[(3-methoxyphenyl)methoxy]ethyl]phenyl]morpholine |
|---|---|
| PubChem CID | 142066874 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | 4-[4-[1-[(3-methoxyphenyl)methoxy]ethyl]phenyl]morpholine |
| SMILES | COc1cccc(COC(C)c2ccc(N3CCOCC3)cc2)c1 |
| InChI | InChI=1S/C20H25NO3/c1-16(24-15-17-4-3-5-20(14-17)22-2)18-6-8-19(9-7-18)21-10-12-23-13-11-21/h3-9,14,16H,10-13,15H2,1-2H3 |
| InChIKey | NNEWXMFDQBYBJZ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|