C14H19N5O2 — CID 136569391
4-[1-[(3-methoxyphenyl)methyl]tetrazol-5-yl]-1,4-oxazepane (PubChem CID 136569391) has the molecular formula C14H19N5O2 and a molecular weight of 289.34 g/mol. Its IUPAC name is 4-[1-[(3-methoxyphenyl)methyl]tetrazol-5-yl]-1,4-oxazepane.
| Compound Name | 4-[1-[(3-methoxyphenyl)methyl]tetrazol-5-yl]-1,4-oxazepane |
|---|---|
| PubChem CID | 136569391 |
| Molecular Formula | C14H19N5O2 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 4-[1-[(3-methoxyphenyl)methyl]tetrazol-5-yl]-1,4-oxazepane |
| SMILES | COc1cccc(Cn2nnnc2N2CCCOCC2)c1 |
| InChI | InChI=1S/C14H19N5O2/c1-20-13-5-2-4-12(10-13)11-19-14(15-16-17-19)18-6-3-8-21-9-7-18/h2,4-5,10H,3,6-9,11H2,1H3 |
| InChIKey | XYDDJWUFABOUJJ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 65.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |