C31H36N4O3 — CID 167466026
N-[(3-methoxyphenyl)methyl]-3-(2-morpholin-4-ylethoxymethyl)-N-[(3-pyrazol-1-ylphenyl)methyl]aniline (PubChem CID 167466026) has the molecular formula C31H36N4O3 and a molecular weight of 512.65 g/mol. Its IUPAC name is N-[(3-methoxyphenyl)methyl]-3-(2-morpholin-4-ylethoxymethyl)-N-[(3-pyrazol-1-ylphenyl)methyl]aniline.
| Compound Name | N-[(3-methoxyphenyl)methyl]-3-(2-morpholin-4-ylethoxymethyl)-N-[(3-pyrazol-1-ylphenyl)methyl]aniline |
|---|---|
| PubChem CID | 167466026 |
| Molecular Formula | C31H36N4O3 |
| Molecular Weight | 512.65 g/mol |
| Exact Mass | 512.28 |
| IUPAC Name | N-[(3-methoxyphenyl)methyl]-3-(2-morpholin-4-ylethoxymethyl)-N-[(3-pyrazol-1-ylphenyl)methyl]aniline |
| SMILES | COc1cccc(CN(Cc2cccc(-n3cccn3)c2)c2cccc(COCCN3CCOCC3)c2)c1 |
| InChI | InChI=1S/C31H36N4O3/c1-36-31-11-4-7-27(22-31)24-34(23-26-6-2-10-30(20-26)35-13-5-12-32-35)29-9-3-8-28(21-29)25-38-19-16-33-14-17-37-18-15-33/h2-13,20-22H,14-19,23-25H2,1H3 |
| InChIKey | SYUWPSZUIAEZSU-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 51.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.65 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|