C29H40N4O4S — CID 167465887
N,N-bis[(3-methoxyphenyl)methyl]-4-[2-[2-(4-methylpiperazin-1-yl)ethoxy]ethoxymethyl]-1,3-thiazol-2-amine (PubChem CID 167465887) has the molecular formula C29H40N4O4S and a molecular weight of 540.73 g/mol. Its IUPAC name is N,N-bis[(3-methoxyphenyl)methyl]-4-[2-[2-(4-methylpiperazin-1-yl)ethoxy]ethoxymethyl]-1,3-thiazol-2-amine.
| Compound Name | N,N-bis[(3-methoxyphenyl)methyl]-4-[2-[2-(4-methylpiperazin-1-yl)ethoxy]ethoxymethyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 167465887 |
| Molecular Formula | C29H40N4O4S |
| Molecular Weight | 540.73 g/mol |
| Exact Mass | 540.28 |
| IUPAC Name | N,N-bis[(3-methoxyphenyl)methyl]-4-[2-[2-(4-methylpiperazin-1-yl)ethoxy]ethoxymethyl]-1,3-thiazol-2-amine |
| SMILES | COc1cccc(CN(Cc2cccc(OC)c2)c2nc(COCCOCCN3CCN(C)CC3)cs2)c1 |
| InChI | InChI=1S/C29H40N4O4S/c1-31-10-12-32(13-11-31)14-15-36-16-17-37-22-26-23-38-29(30-26)33(20-24-6-4-8-27(18-24)34-2)21-25-7-5-9-28(19-25)35-3/h4-9,18-19,23H,10-17,20-22H2,1-3H3 |
| InChIKey | KAMWNEMXBFHYQH-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 59.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.73 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|