C26H33N3O5 — CID 167465454
N-[[3-(2-methoxyethoxy)phenyl]methyl]-N-[(3-methoxyphenyl)methyl]-4-(morpholin-4-ylmethyl)-1,3-oxazol-2-amine (PubChem CID 167465454) has the molecular formula C26H33N3O5 and a molecular weight of 467.57 g/mol. Its IUPAC name is N-[[3-(2-methoxyethoxy)phenyl]methyl]-N-[(3-methoxyphenyl)methyl]-4-(morpholin-4-ylmethyl)-1,3-oxazol-2-amine.
| Compound Name | N-[[3-(2-methoxyethoxy)phenyl]methyl]-N-[(3-methoxyphenyl)methyl]-4-(morpholin-4-ylmethyl)-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 167465454 |
| Molecular Formula | C26H33N3O5 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | N-[[3-(2-methoxyethoxy)phenyl]methyl]-N-[(3-methoxyphenyl)methyl]-4-(morpholin-4-ylmethyl)-1,3-oxazol-2-amine |
| SMILES | COCCOc1cccc(CN(Cc2cccc(OC)c2)c2nc(CN3CCOCC3)co2)c1 |
| InChI | InChI=1S/C26H33N3O5/c1-30-13-14-33-25-8-4-6-22(16-25)18-29(17-21-5-3-7-24(15-21)31-2)26-27-23(20-34-26)19-28-9-11-32-12-10-28/h3-8,15-16,20H,9-14,17-19H2,1-2H3 |
| InChIKey | IRWVGQRJRFWKPV-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 69.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|