C30H32N2O2 — CID 70842745
1-N-ethyl-4-N,4-N-bis[(3-methoxyphenyl)methyl]-1-N-phenylbenzene-1,4-diamine (PubChem CID 70842745) has the molecular formula C30H32N2O2 and a molecular weight of 452.60 g/mol. Its IUPAC name is 1-N-ethyl-4-N,4-N-bis[(3-methoxyphenyl)methyl]-1-N-phenylbenzene-1,4-diamine.
| Compound Name | 1-N-ethyl-4-N,4-N-bis[(3-methoxyphenyl)methyl]-1-N-phenylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 70842745 |
| Molecular Formula | C30H32N2O2 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.25 |
| IUPAC Name | 1-N-ethyl-4-N,4-N-bis[(3-methoxyphenyl)methyl]-1-N-phenylbenzene-1,4-diamine |
| SMILES | CCN(c1ccccc1)c1ccc(N(Cc2cccc(OC)c2)Cc2cccc(OC)c2)cc1 |
| InChI | InChI=1S/C30H32N2O2/c1-4-32(27-12-6-5-7-13-27)28-18-16-26(17-19-28)31(22-24-10-8-14-29(20-24)33-2)23-25-11-9-15-30(21-25)34-3/h5-21H,4,22-23H2,1-3H3 |
| InChIKey | NSQRKUYZZLUWEN-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|