C27H30N4O — CID 167465619
4-[(dimethylamino)methyl]-N-[(4-imidazol-1-ylphenyl)methyl]-N-[(3-methoxyphenyl)methyl]aniline (PubChem CID 167465619) has the molecular formula C27H30N4O and a molecular weight of 426.56 g/mol. Its IUPAC name is 4-[(dimethylamino)methyl]-N-[(4-imidazol-1-ylphenyl)methyl]-N-[(3-methoxyphenyl)methyl]aniline.
| Compound Name | 4-[(dimethylamino)methyl]-N-[(4-imidazol-1-ylphenyl)methyl]-N-[(3-methoxyphenyl)methyl]aniline |
|---|---|
| PubChem CID | 167465619 |
| Molecular Formula | C27H30N4O |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | 4-[(dimethylamino)methyl]-N-[(4-imidazol-1-ylphenyl)methyl]-N-[(3-methoxyphenyl)methyl]aniline |
| SMILES | COc1cccc(CN(Cc2ccc(-n3ccnc3)cc2)c2ccc(CN(C)C)cc2)c1 |
| InChI | InChI=1S/C27H30N4O/c1-29(2)18-22-7-13-26(14-8-22)31(20-24-5-4-6-27(17-24)32-3)19-23-9-11-25(12-10-23)30-16-15-28-21-30/h4-17,21H,18-20H2,1-3H3 |
| InChIKey | BKXNKYWRJXBIFR-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|