C29H31N5O2 — CID 167465768
1-[[4-[(4-imidazol-1-ylphenyl)methyl-[(3-methoxyphenyl)methyl]amino]phenyl]methyl]piperazin-2-one (PubChem CID 167465768) has the molecular formula C29H31N5O2 and a molecular weight of 481.60 g/mol. Its IUPAC name is 1-[[4-[(4-imidazol-1-ylphenyl)methyl-[(3-methoxyphenyl)methyl]amino]phenyl]methyl]piperazin-2-one.
| Compound Name | 1-[[4-[(4-imidazol-1-ylphenyl)methyl-[(3-methoxyphenyl)methyl]amino]phenyl]methyl]piperazin-2-one |
|---|---|
| PubChem CID | 167465768 |
| Molecular Formula | C29H31N5O2 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.25 |
| IUPAC Name | 1-[[4-[(4-imidazol-1-ylphenyl)methyl-[(3-methoxyphenyl)methyl]amino]phenyl]methyl]piperazin-2-one |
| SMILES | COc1cccc(CN(Cc2ccc(-n3ccnc3)cc2)c2ccc(CN3CCNCC3=O)cc2)c1 |
| InChI | InChI=1S/C29H31N5O2/c1-36-28-4-2-3-25(17-28)21-34(20-24-5-9-26(10-6-24)33-16-14-31-22-33)27-11-7-23(8-12-27)19-32-15-13-30-18-29(32)35/h2-12,14,16-17,22,30H,13,15,18-21H2,1H3 |
| InChIKey | IIIAEORWEHFXTQ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|