C37H25N2O2Pt- — CID 164742542
2-[5-benzyl-4-(3-pyridin-2-ylbenzene-2-id-1-yl)-1,3-benzoxazol-2-yl]-4-phenylphenol;platinum (PubChem CID 164742542) has the molecular formula C37H25N2O2Pt- and a molecular weight of 724.70 g/mol. Its IUPAC name is 2-[5-benzyl-4-(3-pyridin-2-ylbenzene-2-id-1-yl)-1,3-benzoxazol-2-yl]-4-phenylphenol;platinum.
| Compound Name | 2-[5-benzyl-4-(3-pyridin-2-ylbenzene-2-id-1-yl)-1,3-benzoxazol-2-yl]-4-phenylphenol;platinum |
|---|---|
| PubChem CID | 164742542 |
| Molecular Formula | C37H25N2O2Pt- |
| Molecular Weight | 724.70 g/mol |
| Exact Mass | 724.16 |
| IUPAC Name | 2-[5-benzyl-4-(3-pyridin-2-ylbenzene-2-id-1-yl)-1,3-benzoxazol-2-yl]-4-phenylphenol;platinum |
| SMILES | Oc1ccc(-c2ccccc2)cc1-c1nc2c(-c3[c-]c(-c4ccccn4)ccc3)c(Cc3ccccc3)ccc2o1.[Pt] |
| InChI | InChI=1S/C37H25N2O2.Pt/c40-33-19-17-27(26-12-5-2-6-13-26)24-31(33)37-39-36-34(41-37)20-18-30(22-25-10-3-1-4-11-25)35(36)29-15-9-14-28(23-29)32-16-7-8-21-38-32;/h1-21,24,40H,22H2;/q-1; |
| InChIKey | CVTPKMXOGDSLMR-UHFFFAOYSA-N |
| XLogP | 8.98 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.70 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|