C62H42N3O2Pt- — CID 164743280
2-[1-(4-phenyldibenzofuran-1-yl)-4-[3-phenyl-5-[4-[4-(1-phenylethyl)phenyl]-2-pyridinyl]benzene-6-id-1-yl]benzimidazol-2-yl]phenol;platinum (PubChem CID 164743280) has the molecular formula C62H42N3O2Pt- and a molecular weight of 1056.12 g/mol. Its IUPAC name is 2-[1-(4-phenyldibenzofuran-1-yl)-4-[3-phenyl-5-[4-[4-(1-phenylethyl)phenyl]-2-pyridinyl]benzene-6-id-1-yl]benzimidazol-2-yl]phenol;platinum.
| Compound Name | 2-[1-(4-phenyldibenzofuran-1-yl)-4-[3-phenyl-5-[4-[4-(1-phenylethyl)phenyl]-2-pyridinyl]benzene-6-id-1-yl]benzimidazol-2-yl]phenol;platinum |
|---|---|
| PubChem CID | 164743280 |
| Molecular Formula | C62H42N3O2Pt- |
| Molecular Weight | 1056.12 g/mol |
| Exact Mass | 1055.29 |
| IUPAC Name | 2-[1-(4-phenyldibenzofuran-1-yl)-4-[3-phenyl-5-[4-[4-(1-phenylethyl)phenyl]-2-pyridinyl]benzene-6-id-1-yl]benzimidazol-2-yl]phenol;platinum |
| SMILES | CC(c1ccccc1)c1ccc(-c2ccnc(-c3[c-]c(-c4cccc5c4nc(-c4ccccc4O)n5-c4ccc(-c5ccccc5)c5oc6ccccc6c45)cc(-c4ccccc4)c3)c2)cc1.[Pt] |
| InChI | InChI=1S/C62H42N3O2.Pt/c1-40(41-16-5-2-6-17-41)42-28-30-44(31-29-42)46-34-35-63-54(39-46)49-37-47(43-18-7-3-8-19-43)36-48(38-49)50-24-15-25-56-60(50)64-62(52-22-11-13-26-57(52)66)65(56)55-33-32-51(45-20-9-4-10-21-45)61-59(55)53-23-12-14-27-58(53)67-61;/h2-37,39-40,66H,1H3;/q-1; |
| InChIKey | FPYCLADTODEHBP-UHFFFAOYSA-N |
| XLogP | 15.98 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1056.12 |
| LogP ≤ 5 | 15.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|