C22H16F3O4S+ — CID 164746363
2,2,2-trifluoroethyl 5-methoxy-2-phenoxathiin-10-ium-10-ylbenzoate (PubChem CID 164746363) has the molecular formula C22H16F3O4S+ and a molecular weight of 433.43 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 5-methoxy-2-phenoxathiin-10-ium-10-ylbenzoate.
| Compound Name | 2,2,2-trifluoroethyl 5-methoxy-2-phenoxathiin-10-ium-10-ylbenzoate |
|---|---|
| PubChem CID | 164746363 |
| Molecular Formula | C22H16F3O4S+ |
| Molecular Weight | 433.43 g/mol |
| Exact Mass | 433.07 |
| IUPAC Name | 2,2,2-trifluoroethyl 5-methoxy-2-phenoxathiin-10-ium-10-ylbenzoate |
| SMILES | COc1ccc([S+]2c3ccccc3Oc3ccccc32)c(C(=O)OCC(F)(F)F)c1 |
| InChI | InChI=1S/C22H16F3O4S/c1-27-14-10-11-18(15(12-14)21(26)28-13-22(23,24)25)30-19-8-4-2-6-16(19)29-17-7-3-5-9-20(17)30/h2-12H,13H2,1H3/q+1 |
| InChIKey | LRCGKIDIAWPTTI-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.43 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|