C14H7F3O4S — CID 10853701
1-(10,10-dioxophenoxathiin-1-yl)-2,2,2-trifluoroethanone (PubChem CID 10853701) has the molecular formula C14H7F3O4S and a molecular weight of 328.27 g/mol. Its IUPAC name is 1-(10,10-dioxophenoxathiin-1-yl)-2,2,2-trifluoroethanone.
| Compound Name | 1-(10,10-dioxophenoxathiin-1-yl)-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 10853701 |
| Molecular Formula | C14H7F3O4S |
| Molecular Weight | 328.27 g/mol |
| Exact Mass | 328.00 |
| IUPAC Name | 1-(10,10-dioxophenoxathiin-1-yl)-2,2,2-trifluoroethanone |
| SMILES | O=C(c1cccc2c1S(=O)(=O)c1ccccc1O2)C(F)(F)F |
| InChI | InChI=1S/C14H7F3O4S/c15-14(16,17)13(18)8-4-3-6-10-12(8)22(19,20)11-7-2-1-5-9(11)21-10/h1-7H |
| InChIKey | SHMUARXAVIMEGJ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.27 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |