C14H8O7S — CID 3535325
10,10-dioxophenoxathiine-1,9-dicarboxylic acid (PubChem CID 3535325) has the molecular formula C14H8O7S and a molecular weight of 320.28 g/mol. Its IUPAC name is 10,10-dioxophenoxathiine-1,9-dicarboxylic acid.
| Compound Name | 10,10-dioxophenoxathiine-1,9-dicarboxylic acid |
|---|---|
| PubChem CID | 3535325 |
| Molecular Formula | C14H8O7S |
| Molecular Weight | 320.28 g/mol |
| Exact Mass | 320.00 |
| IUPAC Name | 10,10-dioxophenoxathiine-1,9-dicarboxylic acid |
| SMILES | O=C(O)c1cccc2c1S(=O)(=O)c1c(cccc1C(=O)O)O2 |
| InChI | InChI=1S/C14H8O7S/c15-13(16)7-3-1-5-9-11(7)22(19,20)12-8(14(17)18)4-2-6-10(12)21-9/h1-6H,(H,15,16)(H,17,18) |
| InChIKey | GWAHIADCSFKKFO-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.28 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |