C28H19F3IO4S+ — CID 164746374
[4-(4-iodobenzoyl)oxyphenyl]-phenyl-[2-(2,2,2-trifluoroethoxycarbonyl)phenyl]sulfanium (PubChem CID 164746374) has the molecular formula C28H19F3IO4S+ and a molecular weight of 635.42 g/mol. Its IUPAC name is [4-(4-iodobenzoyl)oxyphenyl]-phenyl-[2-(2,2,2-trifluoroethoxycarbonyl)phenyl]sulfanium.
| Compound Name | [4-(4-iodobenzoyl)oxyphenyl]-phenyl-[2-(2,2,2-trifluoroethoxycarbonyl)phenyl]sulfanium |
|---|---|
| PubChem CID | 164746374 |
| Molecular Formula | C28H19F3IO4S+ |
| Molecular Weight | 635.42 g/mol |
| Exact Mass | 635.00 |
| IUPAC Name | [4-(4-iodobenzoyl)oxyphenyl]-phenyl-[2-(2,2,2-trifluoroethoxycarbonyl)phenyl]sulfanium |
| SMILES | O=C(Oc1ccc([S+](c2ccccc2)c2ccccc2C(=O)OCC(F)(F)F)cc1)c1ccc(I)cc1 |
| InChI | InChI=1S/C28H19F3IO4S/c29-28(30,31)18-35-27(34)24-8-4-5-9-25(24)37(22-6-2-1-3-7-22)23-16-14-21(15-17-23)36-26(33)19-10-12-20(32)13-11-19/h1-17H,18H2/q+1 |
| InChIKey | VCQSAXBCKJNLCF-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.42 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|