C43H51N2+ — CID 164749185
16-cyclohexyl-22,22-dimethyl-1',3'-di(pentan-3-yl)spiro[13-aza-11-azoniahexacyclo[16.3.1.02,7.09,21.011,20.014,19]docosa-1(21),2,4,6,8,11(20),12,14,16,18-decaene-10,5'-cyclohexa-1,3-diene] (PubChem CID 164749185) has the molecular formula C43H51N2+ and a molecular weight of 595.90 g/mol. Its IUPAC name is 16-cyclohexyl-22,22-dimethyl-1',3'-di(pentan-3-yl)spiro[13-aza-11-azoniahexacyclo[16.3.1.02,7.09,21.011,20.014,19]docosa-1(21),2,4,6,8,11(20),12,14,16,18-decaene-10,5'-cyclohexa-1,3-diene].
| Compound Name | 16-cyclohexyl-22,22-dimethyl-1',3'-di(pentan-3-yl)spiro[13-aza-11-azoniahexacyclo[16.3.1.02,7.09,21.011,20.014,19]docosa-1(21),2,4,6,8,11(20),12,14,16,18-decaene-10,5'-cyclohexa-1,3-diene] |
|---|---|
| PubChem CID | 164749185 |
| Molecular Formula | C43H51N2+ |
| Molecular Weight | 595.90 g/mol |
| Exact Mass | 595.40 |
| IUPAC Name | 16-cyclohexyl-22,22-dimethyl-1',3'-di(pentan-3-yl)spiro[13-aza-11-azoniahexacyclo[16.3.1.02,7.09,21.011,20.014,19]docosa-1(21),2,4,6,8,11(20),12,14,16,18-decaene-10,5'-cyclohexa-1,3-diene] |
| SMILES | CCC(CC)C1=CC2(CC(C(CC)CC)=C1)c1cc3ccccc3c3c1-c1c4c(cc(C5CCCCC5)cc4nc[n+]12)C3(C)C |
| InChI | InChI=1S/C43H51N2/c1-7-27(8-2)32-20-33(28(9-3)10-4)25-43(24-32)36-21-30-18-14-15-19-34(30)40-39(36)41-38-35(42(40,5)6)22-31(29-16-12-11-13-17-29)23-37(38)44-26-45(41)43/h14-15,18-24,26-29H,7-13,16-17,25H2,1-6H3/q+1 |
| InChIKey | GDFVLQPDFCNTTH-UHFFFAOYSA-N |
| XLogP | 11.22 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.90 |
| LogP ≤ 5 | 11.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|