C38H43N2+ — CID 164749076
6,22,22-trimethyl-1',3'-di(pentan-3-yl)spiro[4-aza-9-azoniahexacyclo[16.3.1.03,8.09,21.011,20.014,19]docosa-1,3(8),4,6,9(21),11(20),12,14(19),15,17-decaene-10,5'-cyclohexa-1,3-diene] (PubChem CID 164749076) has the molecular formula C38H43N2+ and a molecular weight of 527.78 g/mol. Its IUPAC name is 6,22,22-trimethyl-1',3'-di(pentan-3-yl)spiro[4-aza-9-azoniahexacyclo[16.3.1.03,8.09,21.011,20.014,19]docosa-1,3(8),4,6,9(21),11(20),12,14(19),15,17-decaene-10,5'-cyclohexa-1,3-diene].
| Compound Name | 6,22,22-trimethyl-1',3'-di(pentan-3-yl)spiro[4-aza-9-azoniahexacyclo[16.3.1.03,8.09,21.011,20.014,19]docosa-1,3(8),4,6,9(21),11(20),12,14(19),15,17-decaene-10,5'-cyclohexa-1,3-diene] |
|---|---|
| PubChem CID | 164749076 |
| Molecular Formula | C38H43N2+ |
| Molecular Weight | 527.78 g/mol |
| Exact Mass | 527.34 |
| IUPAC Name | 6,22,22-trimethyl-1',3'-di(pentan-3-yl)spiro[4-aza-9-azoniahexacyclo[16.3.1.03,8.09,21.011,20.014,19]docosa-1,3(8),4,6,9(21),11(20),12,14(19),15,17-decaene-10,5'-cyclohexa-1,3-diene] |
| SMILES | CCC(CC)C1=CC2(CC(C(CC)CC)=C1)c1ccc3cccc4c3c1-c1c(cc3ncc(C)cc3[n+]12)C4(C)C |
| InChI | InChI=1S/C38H43N2/c1-8-24(9-2)27-18-28(25(10-3)11-4)21-38(20-27)30-16-15-26-13-12-14-29-34(26)35(30)36-31(37(29,6)7)19-32-33(40(36)38)17-23(5)22-39-32/h12-20,22,24-25H,8-11,21H2,1-7H3/q+1 |
| InChIKey | GBKLEVZWBYOZTP-UHFFFAOYSA-N |
| XLogP | 9.48 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.78 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|