C12H12N2O — CID 164750840
4-(1,2,3,4-tetrahydropyridin-6-yl)-1,3-benzoxazole (PubChem CID 164750840) has the molecular formula C12H12N2O and a molecular weight of 200.24 g/mol. Its IUPAC name is 4-(1,2,3,4-tetrahydropyridin-6-yl)-1,3-benzoxazole.
| Compound Name | 4-(1,2,3,4-tetrahydropyridin-6-yl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 164750840 |
| Molecular Formula | C12H12N2O |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | 4-(1,2,3,4-tetrahydropyridin-6-yl)-1,3-benzoxazole |
| SMILES | C1=C(c2cccc3ocnc23)NCCC1 |
| InChI | InChI=1S/C12H12N2O/c1-2-7-13-10(5-1)9-4-3-6-11-12(9)14-8-15-11/h3-6,8,13H,1-2,7H2 |
| InChIKey | QLOOAUFSXZTCSF-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |