C20H17F3N4O4 — CID 164752439
2-[5-methyl-2-(3,4,5-trifluorophenyl)piperidin-1-yl]-2-oxo-N-(3-oxo-[1,2]oxazolo[5,4-b]pyridin-5-yl)acetamide (PubChem CID 164752439) has the molecular formula C20H17F3N4O4 and a molecular weight of 434.37 g/mol. Its IUPAC name is 2-[5-methyl-2-(3,4,5-trifluorophenyl)piperidin-1-yl]-2-oxo-N-(3-oxo-[1,2]oxazolo[5,4-b]pyridin-5-yl)acetamide.
| Compound Name | 2-[5-methyl-2-(3,4,5-trifluorophenyl)piperidin-1-yl]-2-oxo-N-(3-oxo-[1,2]oxazolo[5,4-b]pyridin-5-yl)acetamide |
|---|---|
| PubChem CID | 164752439 |
| Molecular Formula | C20H17F3N4O4 |
| Molecular Weight | 434.37 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | 2-[5-methyl-2-(3,4,5-trifluorophenyl)piperidin-1-yl]-2-oxo-N-(3-oxo-[1,2]oxazolo[5,4-b]pyridin-5-yl)acetamide |
| SMILES | CC1CCC(c2cc(F)c(F)c(F)c2)N(C(=O)C(=O)Nc2cnc3o[nH]c(=O)c3c2)C1 |
| InChI | InChI=1S/C20H17F3N4O4/c1-9-2-3-15(10-4-13(21)16(23)14(22)5-10)27(8-9)20(30)18(29)25-11-6-12-17(28)26-31-19(12)24-7-11/h4-7,9,15H,2-3,8H2,1H3,(H,25,29)(H,26,28) |
| InChIKey | IJAXATMCBWGLGC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.37 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|