C21H24F4N4O3 — CID 164753365
N'-(6-amino-5-methyl-3-pyridinyl)-N-[(2R)-5-(4-fluorophenyl)-2-methyl-3-(trifluoromethoxy)pentyl]oxamide (PubChem CID 164753365) has the molecular formula C21H24F4N4O3 and a molecular weight of 456.44 g/mol. Its IUPAC name is N'-(6-amino-5-methyl-3-pyridinyl)-N-[(2R)-5-(4-fluorophenyl)-2-methyl-3-(trifluoromethoxy)pentyl]oxamide.
| Compound Name | N'-(6-amino-5-methyl-3-pyridinyl)-N-[(2R)-5-(4-fluorophenyl)-2-methyl-3-(trifluoromethoxy)pentyl]oxamide |
|---|---|
| PubChem CID | 164753365 |
| Molecular Formula | C21H24F4N4O3 |
| Molecular Weight | 456.44 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | N'-(6-amino-5-methyl-3-pyridinyl)-N-[(2R)-5-(4-fluorophenyl)-2-methyl-3-(trifluoromethoxy)pentyl]oxamide |
| SMILES | Cc1cc(NC(=O)C(=O)NC[C@@H](C)C(CCc2ccc(F)cc2)OC(F)(F)F)cnc1N |
| InChI | InChI=1S/C21H24F4N4O3/c1-12-9-16(11-27-18(12)26)29-20(31)19(30)28-10-13(2)17(32-21(23,24)25)8-5-14-3-6-15(22)7-4-14/h3-4,6-7,9,11,13,17H,5,8,10H2,1-2H3,(H2,26,27)(H,28,30)(H,29,31)/t13-,17?/m1/s1 |
| InChIKey | HCVRBQWAOSVBAR-FWJOYPJLSA-N |
| XLogP | 3.34 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.44 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|